C25H24FN3O4S — CID 55584138
N-[1-[4-(cyclopropanecarbonylamino)phenyl]ethyl]-4-[(2-fluorophenyl)sulfamoyl]benzamide (PubChem CID 55584138) has the molecular formula C25H24FN3O4S and a molecular weight of 481.55 g/mol. Its IUPAC name is N-[1-[4-(cyclopropanecarbonylamino)phenyl]ethyl]-4-[(2-fluorophenyl)sulfamoyl]benzamide.
| Compound Name | N-[1-[4-(cyclopropanecarbonylamino)phenyl]ethyl]-4-[(2-fluorophenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 55584138 |
| Molecular Formula | C25H24FN3O4S |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.15 |
| IUPAC Name | N-[1-[4-(cyclopropanecarbonylamino)phenyl]ethyl]-4-[(2-fluorophenyl)sulfamoyl]benzamide |
| SMILES | CC(NC(=O)c1ccc(S(=O)(=O)Nc2ccccc2F)cc1)c1ccc(NC(=O)C2CC2)cc1 |
| InChI | InChI=1S/C25H24FN3O4S/c1-16(17-8-12-20(13-9-17)28-25(31)18-6-7-18)27-24(30)19-10-14-21(15-11-19)34(32,33)29-23-5-3-2-4-22(23)26/h2-5,8-16,18,29H,6-7H2,1H3,(H,27,30)(H,28,31) |
| InChIKey | SJQVSUSCIWUHIV-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |