C19H29NO4 — CID 55584646
methyl 2-methyl-2-[[2-(5-methyl-2-propan-2-ylphenoxy)acetyl]amino]pentanoate (PubChem CID 55584646) has the molecular formula C19H29NO4 and a molecular weight of 335.44 g/mol. Its IUPAC name is methyl 2-methyl-2-[[2-(5-methyl-2-propan-2-ylphenoxy)acetyl]amino]pentanoate.
| Compound Name | methyl 2-methyl-2-[[2-(5-methyl-2-propan-2-ylphenoxy)acetyl]amino]pentanoate |
|---|---|
| PubChem CID | 55584646 |
| Molecular Formula | C19H29NO4 |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | methyl 2-methyl-2-[[2-(5-methyl-2-propan-2-ylphenoxy)acetyl]amino]pentanoate |
| SMILES | CCCC(C)(NC(=O)COc1cc(C)ccc1C(C)C)C(=O)OC |
| InChI | InChI=1S/C19H29NO4/c1-7-10-19(5,18(22)23-6)20-17(21)12-24-16-11-14(4)8-9-15(16)13(2)3/h8-9,11,13H,7,10,12H2,1-6H3,(H,20,21) |
| InChIKey | RKTNRZOPQQQWCM-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |