C15H14Cl2N2O2S — CID 55585286
N-[1-(3-acetamidophenyl)ethyl]-2,5-dichlorothiophene-3-carboxamide (PubChem CID 55585286) has the molecular formula C15H14Cl2N2O2S and a molecular weight of 357.26 g/mol. Its IUPAC name is N-[1-(3-acetamidophenyl)ethyl]-2,5-dichlorothiophene-3-carboxamide.
| Compound Name | N-[1-(3-acetamidophenyl)ethyl]-2,5-dichlorothiophene-3-carboxamide |
|---|---|
| PubChem CID | 55585286 |
| Molecular Formula | C15H14Cl2N2O2S |
| Molecular Weight | 357.26 g/mol |
| Exact Mass | 356.02 |
| IUPAC Name | N-[1-(3-acetamidophenyl)ethyl]-2,5-dichlorothiophene-3-carboxamide |
| SMILES | CC(=O)Nc1cccc(C(C)NC(=O)c2cc(Cl)sc2Cl)c1 |
| InChI | InChI=1S/C15H14Cl2N2O2S/c1-8(10-4-3-5-11(6-10)19-9(2)20)18-15(21)12-7-13(16)22-14(12)17/h3-8H,1-2H3,(H,18,21)(H,19,20) |
| InChIKey | JOWAZGRDRSNWJR-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.26 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |