C22H38N2O2 — CID 55587581
1-N,4-N-dicyclopentyl-1-N,4-N-diethylcyclohexane-1,4-dicarboxamide (PubChem CID 55587581) has the molecular formula C22H38N2O2 and a molecular weight of 362.56 g/mol. Its IUPAC name is 1-N,4-N-dicyclopentyl-1-N,4-N-diethylcyclohexane-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-dicyclopentyl-1-N,4-N-diethylcyclohexane-1,4-dicarboxamide |
|---|---|
| PubChem CID | 55587581 |
| Molecular Formula | C22H38N2O2 |
| Molecular Weight | 362.56 g/mol |
| Exact Mass | 362.29 |
| IUPAC Name | 1-N,4-N-dicyclopentyl-1-N,4-N-diethylcyclohexane-1,4-dicarboxamide |
| SMILES | CCN(C(=O)C1CCC(C(=O)N(CC)C2CCCC2)CC1)C1CCCC1 |
| InChI | InChI=1S/C22H38N2O2/c1-3-23(19-9-5-6-10-19)21(25)17-13-15-18(16-14-17)22(26)24(4-2)20-11-7-8-12-20/h17-20H,3-16H2,1-2H3 |
| InChIKey | JXTSTFNWYRMJQY-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.56 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |