C23H28N4O2 — CID 55587877
5-oxo-1-(3-propan-2-ylphenyl)-N-(5-pyrrolidin-1-yl-2-pyridinyl)pyrrolidine-3-carboxamide (PubChem CID 55587877) has the molecular formula C23H28N4O2 and a molecular weight of 392.50 g/mol. Its IUPAC name is 5-oxo-1-(3-propan-2-ylphenyl)-N-(5-pyrrolidin-1-yl-2-pyridinyl)pyrrolidine-3-carboxamide.
| Compound Name | 5-oxo-1-(3-propan-2-ylphenyl)-N-(5-pyrrolidin-1-yl-2-pyridinyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 55587877 |
| Molecular Formula | C23H28N4O2 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | 5-oxo-1-(3-propan-2-ylphenyl)-N-(5-pyrrolidin-1-yl-2-pyridinyl)pyrrolidine-3-carboxamide |
| SMILES | CC(C)c1cccc(N2CC(C(=O)Nc3ccc(N4CCCC4)cn3)CC2=O)c1 |
| InChI | InChI=1S/C23H28N4O2/c1-16(2)17-6-5-7-19(12-17)27-15-18(13-22(27)28)23(29)25-21-9-8-20(14-24-21)26-10-3-4-11-26/h5-9,12,14,16,18H,3-4,10-11,13,15H2,1-2H3,(H,24,25,29) |
| InChIKey | LDPSDFOSFIIFGR-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |