C20H22N4O3 — CID 55587993
(E)-N-[(4-cyanophenyl)methyl]-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)-N-propylprop-2-enamide (PubChem CID 55587993) has the molecular formula C20H22N4O3 and a molecular weight of 366.42 g/mol. Its IUPAC name is (E)-N-[(4-cyanophenyl)methyl]-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)-N-propylprop-2-enamide.
| Compound Name | (E)-N-[(4-cyanophenyl)methyl]-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)-N-propylprop-2-enamide |
|---|---|
| PubChem CID | 55587993 |
| Molecular Formula | C20H22N4O3 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | (E)-N-[(4-cyanophenyl)methyl]-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)-N-propylprop-2-enamide |
| SMILES | CCCN(Cc1ccc(C#N)cc1)C(=O)/C=C/c1cn(C)c(=O)n(C)c1=O |
| InChI | InChI=1S/C20H22N4O3/c1-4-11-24(13-16-7-5-15(12-21)6-8-16)18(25)10-9-17-14-22(2)20(27)23(3)19(17)26/h5-10,14H,4,11,13H2,1-3H3/b10-9+ |
| InChIKey | PCSIUONQWCINEJ-MDZDMXLPSA-N |
| XLogP | 1.41 |
| TPSA | 88.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|