C16H17ClN4O5S2 — CID 55588751
N-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-9-carboxamide (PubChem CID 55588751) has the molecular formula C16H17ClN4O5S2 and a molecular weight of 444.92 g/mol. Its IUPAC name is N-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-9-carboxamide.
| Compound Name | N-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-9-carboxamide |
|---|---|
| PubChem CID | 55588751 |
| Molecular Formula | C16H17ClN4O5S2 |
| Molecular Weight | 444.92 g/mol |
| Exact Mass | 444.03 |
| IUPAC Name | N-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-9-carboxamide |
| SMILES | O=C(NCCNS(=O)(=O)c1cccc(Cl)c1)C1=CC=CN2CCS(=O)(=O)N=C12 |
| InChI | InChI=1S/C16H17ClN4O5S2/c17-12-3-1-4-13(11-12)28(25,26)19-7-6-18-16(22)14-5-2-8-21-9-10-27(23,24)20-15(14)21/h1-5,8,11,19H,6-7,9-10H2,(H,18,22) |
| InChIKey | PHZZYBSMKTYJQA-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 125.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.92 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|