C17H24FNO — CID 55590411
1-(3-fluorophenyl)-N-methyl-N-(2-methylpropyl)cyclopentane-1-carboxamide (PubChem CID 55590411) has the molecular formula C17H24FNO and a molecular weight of 277.38 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-N-methyl-N-(2-methylpropyl)cyclopentane-1-carboxamide.
| Compound Name | 1-(3-fluorophenyl)-N-methyl-N-(2-methylpropyl)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 55590411 |
| Molecular Formula | C17H24FNO |
| Molecular Weight | 277.38 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | 1-(3-fluorophenyl)-N-methyl-N-(2-methylpropyl)cyclopentane-1-carboxamide |
| SMILES | CC(C)CN(C)C(=O)C1(c2cccc(F)c2)CCCC1 |
| InChI | InChI=1S/C17H24FNO/c1-13(2)12-19(3)16(20)17(9-4-5-10-17)14-7-6-8-15(18)11-14/h6-8,11,13H,4-5,9-10,12H2,1-3H3 |
| InChIKey | OMFGIVXDASSXCU-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.38 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |