C19H28N6O3S — CID 55590441
1-[[2-(dimethylsulfamoyl)phenyl]methyl]-3-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]urea (PubChem CID 55590441) has the molecular formula C19H28N6O3S and a molecular weight of 420.54 g/mol. Its IUPAC name is 1-[[2-(dimethylsulfamoyl)phenyl]methyl]-3-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]urea.
| Compound Name | 1-[[2-(dimethylsulfamoyl)phenyl]methyl]-3-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]urea |
|---|---|
| PubChem CID | 55590441 |
| Molecular Formula | C19H28N6O3S |
| Molecular Weight | 420.54 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | 1-[[2-(dimethylsulfamoyl)phenyl]methyl]-3-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]urea |
| SMILES | CN(C)S(=O)(=O)c1ccccc1CNC(=O)NCCc1nnc2n1CCCCC2 |
| InChI | InChI=1S/C19H28N6O3S/c1-24(2)29(27,28)16-9-6-5-8-15(16)14-21-19(26)20-12-11-18-23-22-17-10-4-3-7-13-25(17)18/h5-6,8-9H,3-4,7,10-14H2,1-2H3,(H2,20,21,26) |
| InChIKey | WHSHPMQMBKHVOU-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 109.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.54 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |