C20H25BrN2O2 — CID 55590657
6-(3-bromophenyl)-N-(2-methoxyethyl)-2-methyl-N-(2-methylpropyl)pyridine-3-carboxamide (PubChem CID 55590657) has the molecular formula C20H25BrN2O2 and a molecular weight of 405.34 g/mol. Its IUPAC name is 6-(3-bromophenyl)-N-(2-methoxyethyl)-2-methyl-N-(2-methylpropyl)pyridine-3-carboxamide.
| Compound Name | 6-(3-bromophenyl)-N-(2-methoxyethyl)-2-methyl-N-(2-methylpropyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 55590657 |
| Molecular Formula | C20H25BrN2O2 |
| Molecular Weight | 405.34 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | 6-(3-bromophenyl)-N-(2-methoxyethyl)-2-methyl-N-(2-methylpropyl)pyridine-3-carboxamide |
| SMILES | COCCN(CC(C)C)C(=O)c1ccc(-c2cccc(Br)c2)nc1C |
| InChI | InChI=1S/C20H25BrN2O2/c1-14(2)13-23(10-11-25-4)20(24)18-8-9-19(22-15(18)3)16-6-5-7-17(21)12-16/h5-9,12,14H,10-11,13H2,1-4H3 |
| InChIKey | LKAVBMVUCWHDKD-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.34 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |