C22H21FN2O3 — CID 55595431
1-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[(3-fluorophenyl)methyl]-2,5-dimethylpyrrole-3-carboxamide (PubChem CID 55595431) has the molecular formula C22H21FN2O3 and a molecular weight of 380.42 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[(3-fluorophenyl)methyl]-2,5-dimethylpyrrole-3-carboxamide.
| Compound Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[(3-fluorophenyl)methyl]-2,5-dimethylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 55595431 |
| Molecular Formula | C22H21FN2O3 |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[(3-fluorophenyl)methyl]-2,5-dimethylpyrrole-3-carboxamide |
| SMILES | Cc1cc(C(=O)NCc2cccc(F)c2)c(C)n1-c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C22H21FN2O3/c1-14-10-19(22(26)24-13-16-4-3-5-17(23)11-16)15(2)25(14)18-6-7-20-21(12-18)28-9-8-27-20/h3-7,10-12H,8-9,13H2,1-2H3,(H,24,26) |
| InChIKey | DEFQBOHAXKOKAO-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|