C21H30N4O2 — CID 55597981
1-cyclooctyl-3-[(2-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]urea (PubChem CID 55597981) has the molecular formula C21H30N4O2 and a molecular weight of 370.50 g/mol. Its IUPAC name is 1-cyclooctyl-3-[(2-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]urea.
| Compound Name | 1-cyclooctyl-3-[(2-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]urea |
|---|---|
| PubChem CID | 55597981 |
| Molecular Formula | C21H30N4O2 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | 1-cyclooctyl-3-[(2-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]urea |
| SMILES | COc1ccccc1C(NC(=O)NC1CCCCCCC1)c1nccn1C |
| InChI | InChI=1S/C21H30N4O2/c1-25-15-14-22-20(25)19(17-12-8-9-13-18(17)27-2)24-21(26)23-16-10-6-4-3-5-7-11-16/h8-9,12-16,19H,3-7,10-11H2,1-2H3,(H2,23,24,26) |
| InChIKey | NLHJOWFNLXMUTC-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |