C24H30N4O3S — CID 55598443
2-[benzyl(prop-2-enyl)amino]-N-[3-(3,4,5,6-tetrahydro-2H-azepin-7-ylsulfamoyl)phenyl]acetamide (PubChem CID 55598443) has the molecular formula C24H30N4O3S and a molecular weight of 454.60 g/mol. Its IUPAC name is 2-[benzyl(prop-2-enyl)amino]-N-[3-(3,4,5,6-tetrahydro-2H-azepin-7-ylsulfamoyl)phenyl]acetamide.
| Compound Name | 2-[benzyl(prop-2-enyl)amino]-N-[3-(3,4,5,6-tetrahydro-2H-azepin-7-ylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 55598443 |
| Molecular Formula | C24H30N4O3S |
| Molecular Weight | 454.60 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | 2-[benzyl(prop-2-enyl)amino]-N-[3-(3,4,5,6-tetrahydro-2H-azepin-7-ylsulfamoyl)phenyl]acetamide |
| SMILES | C=CCN(CC(=O)Nc1cccc(S(=O)(=O)NC2=NCCCCC2)c1)Cc1ccccc1 |
| InChI | InChI=1S/C24H30N4O3S/c1-2-16-28(18-20-10-5-3-6-11-20)19-24(29)26-21-12-9-13-22(17-21)32(30,31)27-23-14-7-4-8-15-25-23/h2-3,5-6,9-13,17H,1,4,7-8,14-16,18-19H2,(H,25,27)(H,26,29) |
| InChIKey | NIDIDAFXQWWTOY-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.60 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|