C21H17N3O4 — CID 55598715
N-[4-[2-(2-cyanophenoxy)propanoylamino]phenyl]furan-2-carboxamide (PubChem CID 55598715) has the molecular formula C21H17N3O4 and a molecular weight of 375.38 g/mol. Its IUPAC name is N-[4-[2-(2-cyanophenoxy)propanoylamino]phenyl]furan-2-carboxamide.
| Compound Name | N-[4-[2-(2-cyanophenoxy)propanoylamino]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 55598715 |
| Molecular Formula | C21H17N3O4 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | N-[4-[2-(2-cyanophenoxy)propanoylamino]phenyl]furan-2-carboxamide |
| SMILES | CC(Oc1ccccc1C#N)C(=O)Nc1ccc(NC(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C21H17N3O4/c1-14(28-18-6-3-2-5-15(18)13-22)20(25)23-16-8-10-17(11-9-16)24-21(26)19-7-4-12-27-19/h2-12,14H,1H3,(H,23,25)(H,24,26) |
| InChIKey | YLPQNZAYRYWBOG-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 104.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |