C28H17N3O4S — CID 55602689
N-(9,10-dioxoanthracen-2-yl)-2-(4-oxo-6-phenylthieno[3,2-d]pyrimidin-3-yl)acetamide (PubChem CID 55602689) has the molecular formula C28H17N3O4S and a molecular weight of 491.53 g/mol. Its IUPAC name is N-(9,10-dioxoanthracen-2-yl)-2-(4-oxo-6-phenylthieno[3,2-d]pyrimidin-3-yl)acetamide.
| Compound Name | N-(9,10-dioxoanthracen-2-yl)-2-(4-oxo-6-phenylthieno[3,2-d]pyrimidin-3-yl)acetamide |
|---|---|
| PubChem CID | 55602689 |
| Molecular Formula | C28H17N3O4S |
| Molecular Weight | 491.53 g/mol |
| Exact Mass | 491.09 |
| IUPAC Name | N-(9,10-dioxoanthracen-2-yl)-2-(4-oxo-6-phenylthieno[3,2-d]pyrimidin-3-yl)acetamide |
| SMILES | O=C(Cn1cnc2cc(-c3ccccc3)sc2c1=O)Nc1ccc2c(c1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C28H17N3O4S/c32-24(14-31-15-29-22-13-23(36-27(22)28(31)35)16-6-2-1-3-7-16)30-17-10-11-20-21(12-17)26(34)19-9-5-4-8-18(19)25(20)33/h1-13,15H,14H2,(H,30,32) |
| InChIKey | GFBZHRUKFWANFY-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 98.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.53 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|