C16H19F3N2O2S — CID 55605998
5-oxo-N-(3-phenylsulfanylpropyl)-1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxamide (PubChem CID 55605998) has the molecular formula C16H19F3N2O2S and a molecular weight of 360.40 g/mol. Its IUPAC name is 5-oxo-N-(3-phenylsulfanylpropyl)-1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxamide.
| Compound Name | 5-oxo-N-(3-phenylsulfanylpropyl)-1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 55605998 |
| Molecular Formula | C16H19F3N2O2S |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 5-oxo-N-(3-phenylsulfanylpropyl)-1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxamide |
| SMILES | O=C(NCCCSc1ccccc1)C1CC(=O)N(CC(F)(F)F)C1 |
| InChI | InChI=1S/C16H19F3N2O2S/c17-16(18,19)11-21-10-12(9-14(21)22)15(23)20-7-4-8-24-13-5-2-1-3-6-13/h1-3,5-6,12H,4,7-11H2,(H,20,23) |
| InChIKey | ZPZNWFYELGYEKJ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.40 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|