C15H14F2N2O2S2 — CID 55606291
N-[2-[2-(difluoromethylsulfanyl)anilino]-2-oxoethyl]-N-methylthiophene-2-carboxamide (PubChem CID 55606291) has the molecular formula C15H14F2N2O2S2 and a molecular weight of 356.42 g/mol. Its IUPAC name is N-[2-[2-(difluoromethylsulfanyl)anilino]-2-oxoethyl]-N-methylthiophene-2-carboxamide.
| Compound Name | N-[2-[2-(difluoromethylsulfanyl)anilino]-2-oxoethyl]-N-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 55606291 |
| Molecular Formula | C15H14F2N2O2S2 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | N-[2-[2-(difluoromethylsulfanyl)anilino]-2-oxoethyl]-N-methylthiophene-2-carboxamide |
| SMILES | CN(CC(=O)Nc1ccccc1SC(F)F)C(=O)c1cccs1 |
| InChI | InChI=1S/C15H14F2N2O2S2/c1-19(14(21)12-7-4-8-22-12)9-13(20)18-10-5-2-3-6-11(10)23-15(16)17/h2-8,15H,9H2,1H3,(H,18,20) |
| InChIKey | IHBHDXUTTBPWDU-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |