About 1-[1-(difluoromethyl)benzimidazol-2-yl]ethyl 1-(2,5-dichlorobenzoyl)pyrrolidine-2-carboxylate
1-[1-(difluoromethyl)benzimidazol-2-yl]ethyl 1-(2,5-dichlorobenzoyl)pyrrolidine-2-carboxylate (PubChem CID 55606652) has the molecular formula C22H19Cl2F2N3O3
and a molecular weight of 482.31 g/mol. Its IUPAC name is 1-[1-(difluoromethyl)benzimidazol-2-yl]ethyl 1-(2,5-dichlorobenzoyl)pyrrolidine-2-carboxylate.
Molecular Properties
| Compound Name | 1-[1-(difluoromethyl)benzimidazol-2-yl]ethyl 1-(2,5-dichlorobenzoyl)pyrrolidine-2-carboxylate |
| PubChem CID | 55606652 |
| Molecular Formula | C22H19Cl2F2N3O3 |
| Molecular Weight | 482.31 g/mol |
| Exact Mass | 481.08 |
| IUPAC Name | 1-[1-(difluoromethyl)benzimidazol-2-yl]ethyl 1-(2,5-dichlorobenzoyl)pyrrolidine-2-carboxylate |
| SMILES | CC(OC(=O)C1CCCN1C(=O)c1cc(Cl)ccc1Cl)c1nc2ccccc2n1C(F)F |
| InChI | InChI=1S/C22H19Cl2F2N3O3/c1-12(19-27-16-5-2-3-6-17(16)29(19)22(25)26)32-21(31)18-7-4-10-28(18)20(30)14-11-13(23)8-9-15(14)24/h2-3,5-6,8-9,11-12,18,22H,4,7,10H2,1H3 |
| InChIKey | XBXLLPODUAAEJA-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 482.31 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[1-(difluoromethyl)benzimidazol-2-yl]ethyl 1-(2,5-dichlorobenzoyl)pyrrolidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(difluoromethyl)benzimidazol-2-yl]ethyl 1-(2,5-dichlorobenzoyl)pyrrolidine-2-carboxylate?
The IUPAC name of 1-[1-(difluoromethyl)benzimidazol-2-yl]ethyl 1-(2,5-dichlorobenzoyl)pyrrolidine-2-carboxylate (CID 55606652) is 1-[1-(difluoromethyl)benzimidazol-2-yl]ethyl 1-(2,5-dichlorobenzoyl)pyrrolidine-2-carboxylate.
What is the SMILES notation for 1-[1-(difluoromethyl)benzimidazol-2-yl]ethyl 1-(2,5-dichlorobenzoyl)pyrrolidine-2-carboxylate?
The canonical SMILES for 1-[1-(difluoromethyl)benzimidazol-2-yl]ethyl 1-(2,5-dichlorobenzoyl)pyrrolidine-2-carboxylate is CC(OC(=O)C1CCCN1C(=O)c1cc(Cl)ccc1Cl)c1nc2ccccc2n1C(F)F.
What is the InChIKey of 1-[1-(difluoromethyl)benzimidazol-2-yl]ethyl 1-(2,5-dichlorobenzoyl)pyrrolidine-2-carboxylate?
The InChIKey is XBXLLPODUAAEJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19Cl2F2N3O3/c1-12(19-27-16-5-2-3-6-17(16)29(19)22(25)26)32-21(31)18-7-4-10-28(18)20(30)14-11-13(23)8-9-15(14)24/h2-3,5-6,8-9,11-12,18,22H,4,7,10H2,1H3.
What are the key properties of 1-[1-(difluoromethyl)benzimidazol-2-yl]ethyl 1-(2,5-dichlorobenzoyl)pyrrolidine-2-carboxylate?
1-[1-(difluoromethyl)benzimidazol-2-yl]ethyl 1-(2,5-dichlorobenzoyl)pyrrolidine-2-carboxylate has a molecular weight of 482.31 g/mol, XLogP of 5.65, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(difluoromethyl)benzimidazol-2-yl]ethyl 1-(2,5-dichlorobenzoyl)pyrrolidine-2-carboxylate is sourced from PubChem (CID 55606652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).