C18H14Cl3N3O — CID 55607208
5-methyl-1-(2-methylphenyl)-N-(2,4,5-trichlorophenyl)pyrazole-4-carboxamide (PubChem CID 55607208) has the molecular formula C18H14Cl3N3O and a molecular weight of 394.69 g/mol. Its IUPAC name is 5-methyl-1-(2-methylphenyl)-N-(2,4,5-trichlorophenyl)pyrazole-4-carboxamide.
| Compound Name | 5-methyl-1-(2-methylphenyl)-N-(2,4,5-trichlorophenyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 55607208 |
| Molecular Formula | C18H14Cl3N3O |
| Molecular Weight | 394.69 g/mol |
| Exact Mass | 393.02 |
| IUPAC Name | 5-methyl-1-(2-methylphenyl)-N-(2,4,5-trichlorophenyl)pyrazole-4-carboxamide |
| SMILES | Cc1ccccc1-n1ncc(C(=O)Nc2cc(Cl)c(Cl)cc2Cl)c1C |
| InChI | InChI=1S/C18H14Cl3N3O/c1-10-5-3-4-6-17(10)24-11(2)12(9-22-24)18(25)23-16-8-14(20)13(19)7-15(16)21/h3-9H,1-2H3,(H,23,25) |
| InChIKey | IPYVKJAQASLDMA-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.69 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|