C21H22Cl2N2O4 — CID 55607440
1-(2,5-dichlorobenzoyl)-N-[2-(4-methoxyphenoxy)ethyl]pyrrolidine-2-carboxamide (PubChem CID 55607440) has the molecular formula C21H22Cl2N2O4 and a molecular weight of 437.32 g/mol. Its IUPAC name is 1-(2,5-dichlorobenzoyl)-N-[2-(4-methoxyphenoxy)ethyl]pyrrolidine-2-carboxamide.
| Compound Name | 1-(2,5-dichlorobenzoyl)-N-[2-(4-methoxyphenoxy)ethyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 55607440 |
| Molecular Formula | C21H22Cl2N2O4 |
| Molecular Weight | 437.32 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | 1-(2,5-dichlorobenzoyl)-N-[2-(4-methoxyphenoxy)ethyl]pyrrolidine-2-carboxamide |
| SMILES | COc1ccc(OCCNC(=O)C2CCCN2C(=O)c2cc(Cl)ccc2Cl)cc1 |
| InChI | InChI=1S/C21H22Cl2N2O4/c1-28-15-5-7-16(8-6-15)29-12-10-24-20(26)19-3-2-11-25(19)21(27)17-13-14(22)4-9-18(17)23/h4-9,13,19H,2-3,10-12H2,1H3,(H,24,26) |
| InChIKey | NSCTUHXOOKTXNJ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.32 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|