C23H17N3O2 — CID 55610557
N-[3-(naphthalene-1-carbonylamino)phenyl]pyridine-4-carboxamide (PubChem CID 55610557) has the molecular formula C23H17N3O2 and a molecular weight of 367.41 g/mol. Its IUPAC name is N-[3-(naphthalene-1-carbonylamino)phenyl]pyridine-4-carboxamide.
| Compound Name | N-[3-(naphthalene-1-carbonylamino)phenyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 55610557 |
| Molecular Formula | C23H17N3O2 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | N-[3-(naphthalene-1-carbonylamino)phenyl]pyridine-4-carboxamide |
| SMILES | O=C(Nc1cccc(NC(=O)c2cccc3ccccc23)c1)c1ccncc1 |
| InChI | InChI=1S/C23H17N3O2/c27-22(17-11-13-24-14-12-17)25-18-7-4-8-19(15-18)26-23(28)21-10-3-6-16-5-1-2-9-20(16)21/h1-15H,(H,25,27)(H,26,28) |
| InChIKey | QURCTHFCWNFCSA-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |