C18H18N2O4S — CID 55611728
2-methyl-5-methylsulfonyl-N-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)benzamide (PubChem CID 55611728) has the molecular formula C18H18N2O4S and a molecular weight of 358.42 g/mol. Its IUPAC name is 2-methyl-5-methylsulfonyl-N-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)benzamide.
| Compound Name | 2-methyl-5-methylsulfonyl-N-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)benzamide |
|---|---|
| PubChem CID | 55611728 |
| Molecular Formula | C18H18N2O4S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | 2-methyl-5-methylsulfonyl-N-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)benzamide |
| SMILES | Cc1ccc(S(C)(=O)=O)cc1C(=O)Nc1ccc2c(c1)CCC(=O)N2 |
| InChI | InChI=1S/C18H18N2O4S/c1-11-3-6-14(25(2,23)24)10-15(11)18(22)19-13-5-7-16-12(9-13)4-8-17(21)20-16/h3,5-7,9-10H,4,8H2,1-2H3,(H,19,22)(H,20,21) |
| InChIKey | SHKTZKCNDQPYNP-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |