C17H16N4O4S — CID 55611894
2,2-dioxo-N-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-9-carboxamide (PubChem CID 55611894) has the molecular formula C17H16N4O4S and a molecular weight of 372.41 g/mol. Its IUPAC name is 2,2-dioxo-N-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-9-carboxamide.
| Compound Name | 2,2-dioxo-N-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-9-carboxamide |
|---|---|
| PubChem CID | 55611894 |
| Molecular Formula | C17H16N4O4S |
| Molecular Weight | 372.41 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | 2,2-dioxo-N-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-9-carboxamide |
| SMILES | O=C1CCc2cc(NC(=O)C3=CC=CN4CCS(=O)(=O)N=C34)ccc2N1 |
| InChI | InChI=1S/C17H16N4O4S/c22-15-6-3-11-10-12(4-5-14(11)19-15)18-17(23)13-2-1-7-21-8-9-26(24,25)20-16(13)21/h1-2,4-5,7,10H,3,6,8-9H2,(H,18,23)(H,19,22) |
| InChIKey | UMDHKABGBNJEEZ-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 107.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.41 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |