C15H13BrINO4 — CID 55612426
methyl 5-[[(5-bromo-2-iodobenzoyl)amino]methyl]-2-methylfuran-3-carboxylate (PubChem CID 55612426) has the molecular formula C15H13BrINO4 and a molecular weight of 478.08 g/mol. Its IUPAC name is methyl 5-[[(5-bromo-2-iodobenzoyl)amino]methyl]-2-methylfuran-3-carboxylate.
| Compound Name | methyl 5-[[(5-bromo-2-iodobenzoyl)amino]methyl]-2-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 55612426 |
| Molecular Formula | C15H13BrINO4 |
| Molecular Weight | 478.08 g/mol |
| Exact Mass | 476.91 |
| IUPAC Name | methyl 5-[[(5-bromo-2-iodobenzoyl)amino]methyl]-2-methylfuran-3-carboxylate |
| SMILES | COC(=O)c1cc(CNC(=O)c2cc(Br)ccc2I)oc1C |
| InChI | InChI=1S/C15H13BrINO4/c1-8-11(15(20)21-2)6-10(22-8)7-18-14(19)12-5-9(16)3-4-13(12)17/h3-6H,7H2,1-2H3,(H,18,19) |
| InChIKey | DZUWGYNJBFMNCW-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.08 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|