C19H19Cl2N3O4S — CID 55615882
1-(3,5-dichlorobenzoyl)-N-[4-(sulfamoylmethyl)phenyl]pyrrolidine-2-carboxamide (PubChem CID 55615882) has the molecular formula C19H19Cl2N3O4S and a molecular weight of 456.35 g/mol. Its IUPAC name is 1-(3,5-dichlorobenzoyl)-N-[4-(sulfamoylmethyl)phenyl]pyrrolidine-2-carboxamide.
| Compound Name | 1-(3,5-dichlorobenzoyl)-N-[4-(sulfamoylmethyl)phenyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 55615882 |
| Molecular Formula | C19H19Cl2N3O4S |
| Molecular Weight | 456.35 g/mol |
| Exact Mass | 455.05 |
| IUPAC Name | 1-(3,5-dichlorobenzoyl)-N-[4-(sulfamoylmethyl)phenyl]pyrrolidine-2-carboxamide |
| SMILES | NS(=O)(=O)Cc1ccc(NC(=O)C2CCCN2C(=O)c2cc(Cl)cc(Cl)c2)cc1 |
| InChI | InChI=1S/C19H19Cl2N3O4S/c20-14-8-13(9-15(21)10-14)19(26)24-7-1-2-17(24)18(25)23-16-5-3-12(4-6-16)11-29(22,27)28/h3-6,8-10,17H,1-2,7,11H2,(H,23,25)(H2,22,27,28) |
| InChIKey | ZJQCZGRFZDVGAV-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.35 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |