About tricyclo[5.3.1.04,9]undec-5-en-2-amine
tricyclo[5.3.1.04,9]undec-5-en-2-amine (PubChem CID 556163) has the molecular formula C11H17N
and a molecular weight of 163.26 g/mol. Its IUPAC name is tricyclo[5.3.1.04,9]undec-5-en-2-amine.
Molecular Properties
| Compound Name | tricyclo[5.3.1.04,9]undec-5-en-2-amine |
| PubChem CID | 556163 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | tricyclo[5.3.1.04,9]undec-5-en-2-amine |
| SMILES | NC1CC2C=CC3CC1CC2C3 |
| InChI | InChI=1S/C11H17N/c12-11-6-8-2-1-7-3-9(8)5-10(11)4-7/h1-2,7-11H,3-6,12H2 |
| InChIKey | ZMXJKGKAUIDCEK-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tricyclo[5.3.1.04,9]undec-5-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tricyclo[5.3.1.04,9]undec-5-en-2-amine?
The IUPAC name of tricyclo[5.3.1.04,9]undec-5-en-2-amine (CID 556163) is tricyclo[5.3.1.04,9]undec-5-en-2-amine.
What is the SMILES notation for tricyclo[5.3.1.04,9]undec-5-en-2-amine?
The canonical SMILES for tricyclo[5.3.1.04,9]undec-5-en-2-amine is NC1CC2C=CC3CC1CC2C3.
What is the InChIKey of tricyclo[5.3.1.04,9]undec-5-en-2-amine?
The InChIKey is ZMXJKGKAUIDCEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N/c12-11-6-8-2-1-7-3-9(8)5-10(11)4-7/h1-2,7-11H,3-6,12H2.
What are the key properties of tricyclo[5.3.1.04,9]undec-5-en-2-amine?
tricyclo[5.3.1.04,9]undec-5-en-2-amine has a molecular weight of 163.26 g/mol, XLogP of 1.94, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tricyclo[5.3.1.04,9]undec-5-en-2-amine is sourced from PubChem (CID 556163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).