C18H18N2O3S — CID 55616686
2-(4-ethoxyphenyl)-N-[2-(furan-2-yl)ethyl]-1,3-thiazole-4-carboxamide (PubChem CID 55616686) has the molecular formula C18H18N2O3S and a molecular weight of 342.42 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)-N-[2-(furan-2-yl)ethyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(4-ethoxyphenyl)-N-[2-(furan-2-yl)ethyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 55616686 |
| Molecular Formula | C18H18N2O3S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | 2-(4-ethoxyphenyl)-N-[2-(furan-2-yl)ethyl]-1,3-thiazole-4-carboxamide |
| SMILES | CCOc1ccc(-c2nc(C(=O)NCCc3ccco3)cs2)cc1 |
| InChI | InChI=1S/C18H18N2O3S/c1-2-22-15-7-5-13(6-8-15)18-20-16(12-24-18)17(21)19-10-9-14-4-3-11-23-14/h3-8,11-12H,2,9-10H2,1H3,(H,19,21) |
| InChIKey | DDQVASXQIRJNLS-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |