C24H27N5O4 — CID 55617288
1-(benzylcarbamoylamino)-N-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]cyclopentane-1-carboxamide (PubChem CID 55617288) has the molecular formula C24H27N5O4 and a molecular weight of 449.51 g/mol. Its IUPAC name is 1-(benzylcarbamoylamino)-N-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]cyclopentane-1-carboxamide.
| Compound Name | 1-(benzylcarbamoylamino)-N-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 55617288 |
| Molecular Formula | C24H27N5O4 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | 1-(benzylcarbamoylamino)-N-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]cyclopentane-1-carboxamide |
| SMILES | O=C(NCc1ccccc1)NC1(C(=O)Nc2cccc(CN3C(=O)CNC3=O)c2)CCCC1 |
| InChI | InChI=1S/C24H27N5O4/c30-20-15-26-23(33)29(20)16-18-9-6-10-19(13-18)27-21(31)24(11-4-5-12-24)28-22(32)25-14-17-7-2-1-3-8-17/h1-3,6-10,13H,4-5,11-12,14-16H2,(H,26,33)(H,27,31)(H2,25,28,32) |
| InChIKey | BBKCFNOZVQGXTL-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 119.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|