C15H16N6O — CID 55621111
N-[[6-(dimethylamino)-3-pyridinyl]methyl]-2H-benzotriazole-5-carboxamide (PubChem CID 55621111) has the molecular formula C15H16N6O and a molecular weight of 296.33 g/mol. Its IUPAC name is N-[[6-(dimethylamino)-3-pyridinyl]methyl]-2H-benzotriazole-5-carboxamide.
| Compound Name | N-[[6-(dimethylamino)-3-pyridinyl]methyl]-2H-benzotriazole-5-carboxamide |
|---|---|
| PubChem CID | 55621111 |
| Molecular Formula | C15H16N6O |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | N-[[6-(dimethylamino)-3-pyridinyl]methyl]-2H-benzotriazole-5-carboxamide |
| SMILES | CN(C)c1ccc(CNC(=O)c2ccc3n[nH]nc3c2)cn1 |
| InChI | InChI=1S/C15H16N6O/c1-21(2)14-6-3-10(8-16-14)9-17-15(22)11-4-5-12-13(7-11)19-20-18-12/h3-8H,9H2,1-2H3,(H,17,22)(H,18,19,20) |
| InChIKey | IPIFOJBDCUTISD-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |