C26H44O4S — CID 556214
2-(3-hydroxy-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl)propyl methanesulfonate (PubChem CID 556214) has the molecular formula C26H44O4S and a molecular weight of 452.70 g/mol. Its IUPAC name is 2-(3-hydroxy-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl)propyl methanesulfonate.
| Compound Name | 2-(3-hydroxy-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl)propyl methanesulfonate |
|---|---|
| PubChem CID | 556214 |
| Molecular Formula | C26H44O4S |
| Molecular Weight | 452.70 g/mol |
| Exact Mass | 452.30 |
| IUPAC Name | 2-(3-hydroxy-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl)propyl methanesulfonate |
| SMILES | CC(COS(C)(=O)=O)C1CCC2(C)C3=C(CCC12C)C1(C)CCC(O)C(C)(C)C1CC3 |
| InChI | InChI=1S/C26H44O4S/c1-17(16-30-31(7,28)29)18-10-14-26(6)20-8-9-21-23(2,3)22(27)12-13-24(21,4)19(20)11-15-25(18,26)5/h17-18,21-22,27H,8-16H2,1-7H3 |
| InChIKey | PYUOUYDEABIRPR-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.70 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|