C24H34N4O5 — CID 55623264
1-[4-[4-[(2,6-dimethylmorpholin-4-yl)methyl]benzoyl]piperazin-1-yl]-2-morpholin-4-ylethane-1,2-dione (PubChem CID 55623264) has the molecular formula C24H34N4O5 and a molecular weight of 458.56 g/mol. Its IUPAC name is 1-[4-[4-[(2,6-dimethylmorpholin-4-yl)methyl]benzoyl]piperazin-1-yl]-2-morpholin-4-ylethane-1,2-dione.
| Compound Name | 1-[4-[4-[(2,6-dimethylmorpholin-4-yl)methyl]benzoyl]piperazin-1-yl]-2-morpholin-4-ylethane-1,2-dione |
|---|---|
| PubChem CID | 55623264 |
| Molecular Formula | C24H34N4O5 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.25 |
| IUPAC Name | 1-[4-[4-[(2,6-dimethylmorpholin-4-yl)methyl]benzoyl]piperazin-1-yl]-2-morpholin-4-ylethane-1,2-dione |
| SMILES | CC1CN(Cc2ccc(C(=O)N3CCN(C(=O)C(=O)N4CCOCC4)CC3)cc2)CC(C)O1 |
| InChI | InChI=1S/C24H34N4O5/c1-18-15-25(16-19(2)33-18)17-20-3-5-21(6-4-20)22(29)26-7-9-27(10-8-26)23(30)24(31)28-11-13-32-14-12-28/h3-6,18-19H,7-17H2,1-2H3 |
| InChIKey | OFCZYJWYDWQDEF-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 82.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|