C22H29N3O4S — CID 55623953
4-[(2,6-dimethylmorpholin-4-yl)methyl]-N-[2-(4-sulfamoylphenyl)ethyl]benzamide (PubChem CID 55623953) has the molecular formula C22H29N3O4S and a molecular weight of 431.56 g/mol. Its IUPAC name is 4-[(2,6-dimethylmorpholin-4-yl)methyl]-N-[2-(4-sulfamoylphenyl)ethyl]benzamide.
| Compound Name | 4-[(2,6-dimethylmorpholin-4-yl)methyl]-N-[2-(4-sulfamoylphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 55623953 |
| Molecular Formula | C22H29N3O4S |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | 4-[(2,6-dimethylmorpholin-4-yl)methyl]-N-[2-(4-sulfamoylphenyl)ethyl]benzamide |
| SMILES | CC1CN(Cc2ccc(C(=O)NCCc3ccc(S(N)(=O)=O)cc3)cc2)CC(C)O1 |
| InChI | InChI=1S/C22H29N3O4S/c1-16-13-25(14-17(2)29-16)15-19-3-7-20(8-4-19)22(26)24-12-11-18-5-9-21(10-6-18)30(23,27)28/h3-10,16-17H,11-15H2,1-2H3,(H,24,26)(H2,23,27,28) |
| InChIKey | ZOHOENHIYGTYSR-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |