C25H26N4O5S — CID 55624173
2-[[4-benzyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]-N-[4-methoxy-3-(2-methoxyethoxy)phenyl]acetamide (PubChem CID 55624173) has the molecular formula C25H26N4O5S and a molecular weight of 494.57 g/mol. Its IUPAC name is 2-[[4-benzyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]-N-[4-methoxy-3-(2-methoxyethoxy)phenyl]acetamide.
| Compound Name | 2-[[4-benzyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]-N-[4-methoxy-3-(2-methoxyethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 55624173 |
| Molecular Formula | C25H26N4O5S |
| Molecular Weight | 494.57 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | 2-[[4-benzyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]-N-[4-methoxy-3-(2-methoxyethoxy)phenyl]acetamide |
| SMILES | COCCOc1cc(NC(=O)CSc2nnc(-c3ccco3)n2Cc2ccccc2)ccc1OC |
| InChI | InChI=1S/C25H26N4O5S/c1-31-13-14-34-22-15-19(10-11-20(22)32-2)26-23(30)17-35-25-28-27-24(21-9-6-12-33-21)29(25)16-18-7-4-3-5-8-18/h3-12,15H,13-14,16-17H2,1-2H3,(H,26,30) |
| InChIKey | FHMTWTQSBGSUOD-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 100.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.57 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|