C9H12O — CID 556249
1,3,3a,4,7,7a-hexahydroinden-2-one (PubChem CID 556249) has the molecular formula C9H12O and a molecular weight of 136.19 g/mol. Its IUPAC name is 1,3,3a,4,7,7a-hexahydroinden-2-one.
| Compound Name | 1,3,3a,4,7,7a-hexahydroinden-2-one |
|---|---|
| PubChem CID | 556249 |
| Molecular Formula | C9H12O |
| Molecular Weight | 136.19 g/mol |
| Exact Mass | 136.09 |
| IUPAC Name | 1,3,3a,4,7,7a-hexahydroinden-2-one |
| SMILES | O=C1CC2CC=CCC2C1 |
| InChI | InChI=1S/C9H12O/c10-9-5-7-3-1-2-4-8(7)6-9/h1-2,7-8H,3-6H2 |
| InChIKey | XTHWLHROZDWGOU-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.19 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|