C18H28N4O4S2 — CID 55625846
N-(2-methylsulfanylphenyl)-3-(4-morpholin-4-ylsulfonylpiperazin-1-yl)propanamide (PubChem CID 55625846) has the molecular formula C18H28N4O4S2 and a molecular weight of 428.58 g/mol. Its IUPAC name is N-(2-methylsulfanylphenyl)-3-(4-morpholin-4-ylsulfonylpiperazin-1-yl)propanamide.
| Compound Name | N-(2-methylsulfanylphenyl)-3-(4-morpholin-4-ylsulfonylpiperazin-1-yl)propanamide |
|---|---|
| PubChem CID | 55625846 |
| Molecular Formula | C18H28N4O4S2 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | N-(2-methylsulfanylphenyl)-3-(4-morpholin-4-ylsulfonylpiperazin-1-yl)propanamide |
| SMILES | CSc1ccccc1NC(=O)CCN1CCN(S(=O)(=O)N2CCOCC2)CC1 |
| InChI | InChI=1S/C18H28N4O4S2/c1-27-17-5-3-2-4-16(17)19-18(23)6-7-20-8-10-21(11-9-20)28(24,25)22-12-14-26-15-13-22/h2-5H,6-15H2,1H3,(H,19,23) |
| InChIKey | RYVGDYNCAQIFSP-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |