About 4-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-N-cyclohexyl-N-methylpiperazine-1-sulfonamide
4-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-N-cyclohexyl-N-methylpiperazine-1-sulfonamide (PubChem CID 55626280) has the molecular formula C19H34N4O3S
and a molecular weight of 398.57 g/mol. Its IUPAC name is 4-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-N-cyclohexyl-N-methylpiperazine-1-sulfonamide.
Molecular Properties
| Compound Name | 4-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-N-cyclohexyl-N-methylpiperazine-1-sulfonamide |
| PubChem CID | 55626280 |
| Molecular Formula | C19H34N4O3S |
| Molecular Weight | 398.57 g/mol |
| Exact Mass | 398.24 |
| IUPAC Name | 4-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-N-cyclohexyl-N-methylpiperazine-1-sulfonamide |
| SMILES | CN(C1CCCCC1)S(=O)(=O)N1CCN(Cc2ncc(C(C)(C)C)o2)CC1 |
| InChI | InChI=1S/C19H34N4O3S/c1-19(2,3)17-14-20-18(26-17)15-22-10-12-23(13-11-22)27(24,25)21(4)16-8-6-5-7-9-16/h14,16H,5-13,15H2,1-4H3 |
| InChIKey | NERDOIVCXUJPOO-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 69.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.57 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-N-cyclohexyl-N-methylpiperazine-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-N-cyclohexyl-N-methylpiperazine-1-sulfonamide?
The IUPAC name of 4-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-N-cyclohexyl-N-methylpiperazine-1-sulfonamide (CID 55626280) is 4-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-N-cyclohexyl-N-methylpiperazine-1-sulfonamide.
What is the SMILES notation for 4-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-N-cyclohexyl-N-methylpiperazine-1-sulfonamide?
The canonical SMILES for 4-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-N-cyclohexyl-N-methylpiperazine-1-sulfonamide is CN(C1CCCCC1)S(=O)(=O)N1CCN(Cc2ncc(C(C)(C)C)o2)CC1.
What is the InChIKey of 4-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-N-cyclohexyl-N-methylpiperazine-1-sulfonamide?
The InChIKey is NERDOIVCXUJPOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H34N4O3S/c1-19(2,3)17-14-20-18(26-17)15-22-10-12-23(13-11-22)27(24,25)21(4)16-8-6-5-7-9-16/h14,16H,5-13,15H2,1-4H3.
What are the key properties of 4-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-N-cyclohexyl-N-methylpiperazine-1-sulfonamide?
4-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-N-cyclohexyl-N-methylpiperazine-1-sulfonamide has a molecular weight of 398.57 g/mol, XLogP of 2.60, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-N-cyclohexyl-N-methylpiperazine-1-sulfonamide is sourced from PubChem (CID 55626280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).