C17H27ClN4O3S — CID 55627423
2-[4-[butyl(methyl)sulfamoyl]piperazin-1-yl]-N-(2-chlorophenyl)acetamide (PubChem CID 55627423) has the molecular formula C17H27ClN4O3S and a molecular weight of 402.95 g/mol. Its IUPAC name is 2-[4-[butyl(methyl)sulfamoyl]piperazin-1-yl]-N-(2-chlorophenyl)acetamide.
| Compound Name | 2-[4-[butyl(methyl)sulfamoyl]piperazin-1-yl]-N-(2-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 55627423 |
| Molecular Formula | C17H27ClN4O3S |
| Molecular Weight | 402.95 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | 2-[4-[butyl(methyl)sulfamoyl]piperazin-1-yl]-N-(2-chlorophenyl)acetamide |
| SMILES | CCCCN(C)S(=O)(=O)N1CCN(CC(=O)Nc2ccccc2Cl)CC1 |
| InChI | InChI=1S/C17H27ClN4O3S/c1-3-4-9-20(2)26(24,25)22-12-10-21(11-13-22)14-17(23)19-16-8-6-5-7-15(16)18/h5-8H,3-4,9-14H2,1-2H3,(H,19,23) |
| InChIKey | JGRLTMOCKPURDG-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.95 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |