C21H25F2N3O5 — CID 55627992
3-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl-methylamino]-N-(2-methyl-4-nitrophenyl)propanamide (PubChem CID 55627992) has the molecular formula C21H25F2N3O5 and a molecular weight of 437.44 g/mol. Its IUPAC name is 3-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl-methylamino]-N-(2-methyl-4-nitrophenyl)propanamide.
| Compound Name | 3-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl-methylamino]-N-(2-methyl-4-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 55627992 |
| Molecular Formula | C21H25F2N3O5 |
| Molecular Weight | 437.44 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | 3-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl-methylamino]-N-(2-methyl-4-nitrophenyl)propanamide |
| SMILES | CCOc1cc(CN(C)CCC(=O)Nc2ccc([N+](=O)[O-])cc2C)ccc1OC(F)F |
| InChI | InChI=1S/C21H25F2N3O5/c1-4-30-19-12-15(5-8-18(19)31-21(22)23)13-25(3)10-9-20(27)24-17-7-6-16(26(28)29)11-14(17)2/h5-8,11-12,21H,4,9-10,13H2,1-3H3,(H,24,27) |
| InChIKey | UHSYDEFUYQPOOS-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.44 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|