C25H28N4O5S — CID 55630194
2-[4-[1-(2-phenoxyacetyl)piperidine-4-carbonyl]piperazin-1-yl]sulfonylbenzonitrile (PubChem CID 55630194) has the molecular formula C25H28N4O5S and a molecular weight of 496.59 g/mol. Its IUPAC name is 2-[4-[1-(2-phenoxyacetyl)piperidine-4-carbonyl]piperazin-1-yl]sulfonylbenzonitrile.
| Compound Name | 2-[4-[1-(2-phenoxyacetyl)piperidine-4-carbonyl]piperazin-1-yl]sulfonylbenzonitrile |
|---|---|
| PubChem CID | 55630194 |
| Molecular Formula | C25H28N4O5S |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.18 |
| IUPAC Name | 2-[4-[1-(2-phenoxyacetyl)piperidine-4-carbonyl]piperazin-1-yl]sulfonylbenzonitrile |
| SMILES | N#Cc1ccccc1S(=O)(=O)N1CCN(C(=O)C2CCN(C(=O)COc3ccccc3)CC2)CC1 |
| InChI | InChI=1S/C25H28N4O5S/c26-18-21-6-4-5-9-23(21)35(32,33)29-16-14-28(15-17-29)25(31)20-10-12-27(13-11-20)24(30)19-34-22-7-2-1-3-8-22/h1-9,20H,10-17,19H2 |
| InChIKey | WNQQFTLLYLOXQR-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 111.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |