C21H17FN4O3 — CID 55631027
N-[2-(cyclopropylcarbamoyl)phenyl]-1-(4-fluorophenyl)-6-oxopyridazine-3-carboxamide (PubChem CID 55631027) has the molecular formula C21H17FN4O3 and a molecular weight of 392.39 g/mol. Its IUPAC name is N-[2-(cyclopropylcarbamoyl)phenyl]-1-(4-fluorophenyl)-6-oxopyridazine-3-carboxamide.
| Compound Name | N-[2-(cyclopropylcarbamoyl)phenyl]-1-(4-fluorophenyl)-6-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 55631027 |
| Molecular Formula | C21H17FN4O3 |
| Molecular Weight | 392.39 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | N-[2-(cyclopropylcarbamoyl)phenyl]-1-(4-fluorophenyl)-6-oxopyridazine-3-carboxamide |
| SMILES | O=C(Nc1ccccc1C(=O)NC1CC1)c1ccc(=O)n(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C21H17FN4O3/c22-13-5-9-15(10-6-13)26-19(27)12-11-18(25-26)21(29)24-17-4-2-1-3-16(17)20(28)23-14-7-8-14/h1-6,9-12,14H,7-8H2,(H,23,28)(H,24,29) |
| InChIKey | QRNOYSIERAGYOG-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.39 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |