C21H21BrClNO3 — CID 55631445
(4-bromo-2-chlorophenyl) 1-(3-phenylpropanoyl)piperidine-4-carboxylate (PubChem CID 55631445) has the molecular formula C21H21BrClNO3 and a molecular weight of 450.76 g/mol. Its IUPAC name is (4-bromo-2-chlorophenyl) 1-(3-phenylpropanoyl)piperidine-4-carboxylate.
| Compound Name | (4-bromo-2-chlorophenyl) 1-(3-phenylpropanoyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 55631445 |
| Molecular Formula | C21H21BrClNO3 |
| Molecular Weight | 450.76 g/mol |
| Exact Mass | 449.04 |
| IUPAC Name | (4-bromo-2-chlorophenyl) 1-(3-phenylpropanoyl)piperidine-4-carboxylate |
| SMILES | O=C(Oc1ccc(Br)cc1Cl)C1CCN(C(=O)CCc2ccccc2)CC1 |
| InChI | InChI=1S/C21H21BrClNO3/c22-17-7-8-19(18(23)14-17)27-21(26)16-10-12-24(13-11-16)20(25)9-6-15-4-2-1-3-5-15/h1-5,7-8,14,16H,6,9-13H2 |
| InChIKey | KOLFBCPYEMXLNT-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.76 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|