C17H15N3O3 — CID 55631453
3-[[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenoxy]methyl]benzamide (PubChem CID 55631453) has the molecular formula C17H15N3O3 and a molecular weight of 309.33 g/mol. Its IUPAC name is 3-[[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenoxy]methyl]benzamide.
| Compound Name | 3-[[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenoxy]methyl]benzamide |
|---|---|
| PubChem CID | 55631453 |
| Molecular Formula | C17H15N3O3 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 3-[[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenoxy]methyl]benzamide |
| SMILES | Cc1nc(-c2ccc(OCc3cccc(C(N)=O)c3)cc2)no1 |
| InChI | InChI=1S/C17H15N3O3/c1-11-19-17(20-23-11)13-5-7-15(8-6-13)22-10-12-3-2-4-14(9-12)16(18)21/h2-9H,10H2,1H3,(H2,18,21) |
| InChIKey | NAVAEIQGELSVIY-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 91.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |