C31H30N2O4 — CID 55633143
methyl 3-[2-[3-[[1-(3-phenylpropanoyl)piperidine-4-carbonyl]amino]phenyl]ethynyl]benzoate (PubChem CID 55633143) has the molecular formula C31H30N2O4 and a molecular weight of 494.59 g/mol. Its IUPAC name is methyl 3-[2-[3-[[1-(3-phenylpropanoyl)piperidine-4-carbonyl]amino]phenyl]ethynyl]benzoate.
| Compound Name | methyl 3-[2-[3-[[1-(3-phenylpropanoyl)piperidine-4-carbonyl]amino]phenyl]ethynyl]benzoate |
|---|---|
| PubChem CID | 55633143 |
| Molecular Formula | C31H30N2O4 |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | methyl 3-[2-[3-[[1-(3-phenylpropanoyl)piperidine-4-carbonyl]amino]phenyl]ethynyl]benzoate |
| SMILES | COC(=O)c1cccc(C#Cc2cccc(NC(=O)C3CCN(C(=O)CCc4ccccc4)CC3)c2)c1 |
| InChI | InChI=1S/C31H30N2O4/c1-37-31(36)27-11-5-9-24(21-27)13-14-25-10-6-12-28(22-25)32-30(35)26-17-19-33(20-18-26)29(34)16-15-23-7-3-2-4-8-23/h2-12,21-22,26H,15-20H2,1H3,(H,32,35) |
| InChIKey | DAEQBULZZGEAPO-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|