C24H31N3O5 — CID 55635303
4-[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethoxy]-N-[6-(2-methoxyethoxy)-3-pyridinyl]benzamide (PubChem CID 55635303) has the molecular formula C24H31N3O5 and a molecular weight of 441.53 g/mol. Its IUPAC name is 4-[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethoxy]-N-[6-(2-methoxyethoxy)-3-pyridinyl]benzamide.
| Compound Name | 4-[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethoxy]-N-[6-(2-methoxyethoxy)-3-pyridinyl]benzamide |
|---|---|
| PubChem CID | 55635303 |
| Molecular Formula | C24H31N3O5 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | 4-[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethoxy]-N-[6-(2-methoxyethoxy)-3-pyridinyl]benzamide |
| SMILES | COCCOc1ccc(NC(=O)c2ccc(OCC(=O)N3C(C)CCCC3C)cc2)cn1 |
| InChI | InChI=1S/C24H31N3O5/c1-17-5-4-6-18(2)27(17)23(28)16-32-21-10-7-19(8-11-21)24(29)26-20-9-12-22(25-15-20)31-14-13-30-3/h7-12,15,17-18H,4-6,13-14,16H2,1-3H3,(H,26,29) |
| InChIKey | IIXFXAXXIGJILL-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 89.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|