C24H27ClN4O5 — CID 55635325
1-[4-[4-(4-chloro-2-nitrophenyl)piperazine-1-carbonyl]piperidin-1-yl]-2-phenoxyethanone (PubChem CID 55635325) has the molecular formula C24H27ClN4O5 and a molecular weight of 486.96 g/mol. Its IUPAC name is 1-[4-[4-(4-chloro-2-nitrophenyl)piperazine-1-carbonyl]piperidin-1-yl]-2-phenoxyethanone.
| Compound Name | 1-[4-[4-(4-chloro-2-nitrophenyl)piperazine-1-carbonyl]piperidin-1-yl]-2-phenoxyethanone |
|---|---|
| PubChem CID | 55635325 |
| Molecular Formula | C24H27ClN4O5 |
| Molecular Weight | 486.96 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | 1-[4-[4-(4-chloro-2-nitrophenyl)piperazine-1-carbonyl]piperidin-1-yl]-2-phenoxyethanone |
| SMILES | O=C(COc1ccccc1)N1CCC(C(=O)N2CCN(c3ccc(Cl)cc3[N+](=O)[O-])CC2)CC1 |
| InChI | InChI=1S/C24H27ClN4O5/c25-19-6-7-21(22(16-19)29(32)33)26-12-14-28(15-13-26)24(31)18-8-10-27(11-9-18)23(30)17-34-20-4-2-1-3-5-20/h1-7,16,18H,8-15,17H2 |
| InChIKey | ZRGAXQYXJCDGGX-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 96.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.96 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|