About 1-cyclobutylcyclobutene
1-cyclobutylcyclobutene (PubChem CID 556361) has the molecular formula C8H12
and a molecular weight of 108.18 g/mol. Its IUPAC name is 1-cyclobutylcyclobutene.
Molecular Properties
| Compound Name | 1-cyclobutylcyclobutene |
| PubChem CID | 556361 |
| Molecular Formula | C8H12 |
| Molecular Weight | 108.18 g/mol |
| Exact Mass | 108.09 |
| IUPAC Name | 1-cyclobutylcyclobutene |
| SMILES | C1=C(C2CCC2)CC1 |
| InChI | InChI=1S/C8H12/c1-3-7(4-1)8-5-2-6-8/h3,8H,1-2,4-6H2 |
| InChIKey | IOMTYJMCCGAODT-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 108.18 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclobutylcyclobutene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclobutylcyclobutene?
The IUPAC name of 1-cyclobutylcyclobutene (CID 556361) is 1-cyclobutylcyclobutene.
What is the SMILES notation for 1-cyclobutylcyclobutene?
The canonical SMILES for 1-cyclobutylcyclobutene is C1=C(C2CCC2)CC1.
What is the InChIKey of 1-cyclobutylcyclobutene?
The InChIKey is IOMTYJMCCGAODT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12/c1-3-7(4-1)8-5-2-6-8/h3,8H,1-2,4-6H2.
What are the key properties of 1-cyclobutylcyclobutene?
1-cyclobutylcyclobutene has a molecular weight of 108.18 g/mol, XLogP of 2.51, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclobutylcyclobutene is sourced from PubChem (CID 556361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).