C20H20N4O3S — CID 55636454
N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-3-(3-oxo-1,4-benzoxazin-4-yl)propanamide (PubChem CID 55636454) has the molecular formula C20H20N4O3S and a molecular weight of 396.47 g/mol. Its IUPAC name is N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-3-(3-oxo-1,4-benzoxazin-4-yl)propanamide.
| Compound Name | N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-3-(3-oxo-1,4-benzoxazin-4-yl)propanamide |
|---|---|
| PubChem CID | 55636454 |
| Molecular Formula | C20H20N4O3S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-3-(3-oxo-1,4-benzoxazin-4-yl)propanamide |
| SMILES | O=C(CCN1C(=O)COc2ccccc21)NCCNc1nc2ccccc2s1 |
| InChI | InChI=1S/C20H20N4O3S/c25-18(9-12-24-15-6-2-3-7-16(15)27-13-19(24)26)21-10-11-22-20-23-14-5-1-4-8-17(14)28-20/h1-8H,9-13H2,(H,21,25)(H,22,23) |
| InChIKey | DJODDFHKEVDBAW-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|