C22H28N4O3 — CID 55639339
N-(2-anilino-2-oxoethyl)-2-(benzylcarbamoylamino)-N,3-dimethylbutanamide (PubChem CID 55639339) has the molecular formula C22H28N4O3 and a molecular weight of 396.49 g/mol. Its IUPAC name is N-(2-anilino-2-oxoethyl)-2-(benzylcarbamoylamino)-N,3-dimethylbutanamide.
| Compound Name | N-(2-anilino-2-oxoethyl)-2-(benzylcarbamoylamino)-N,3-dimethylbutanamide |
|---|---|
| PubChem CID | 55639339 |
| Molecular Formula | C22H28N4O3 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | N-(2-anilino-2-oxoethyl)-2-(benzylcarbamoylamino)-N,3-dimethylbutanamide |
| SMILES | CC(C)C(NC(=O)NCc1ccccc1)C(=O)N(C)CC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C22H28N4O3/c1-16(2)20(25-22(29)23-14-17-10-6-4-7-11-17)21(28)26(3)15-19(27)24-18-12-8-5-9-13-18/h4-13,16,20H,14-15H2,1-3H3,(H,24,27)(H2,23,25,29) |
| InChIKey | ULOJWHYNZNUVDR-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |