C10H14O4 — CID 556403
dimethyl 2-prop-1-enylcyclopropane-1,1-dicarboxylate (PubChem CID 556403) has the molecular formula C10H14O4 and a molecular weight of 198.22 g/mol. Its IUPAC name is dimethyl 2-prop-1-enylcyclopropane-1,1-dicarboxylate.
| Compound Name | dimethyl 2-prop-1-enylcyclopropane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 556403 |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | dimethyl 2-prop-1-enylcyclopropane-1,1-dicarboxylate |
| SMILES | CC=CC1CC1(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C10H14O4/c1-4-5-7-6-10(7,8(11)13-2)9(12)14-3/h4-5,7H,6H2,1-3H3 |
| InChIKey | MWEQOMFDSQABGO-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|