About tetracyclo[5.2.1.02,6.04,8]decane-5,10-diol
tetracyclo[5.2.1.02,6.04,8]decane-5,10-diol (PubChem CID 556428) has the molecular formula C10H14O2
and a molecular weight of 166.22 g/mol. Its IUPAC name is tetracyclo[5.2.1.02,6.04,8]decane-5,10-diol.
Molecular Properties
| Compound Name | tetracyclo[5.2.1.02,6.04,8]decane-5,10-diol |
| PubChem CID | 556428 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | tetracyclo[5.2.1.02,6.04,8]decane-5,10-diol |
| SMILES | OC1C2CC3C4CC2C(C4O)C13 |
| InChI | InChI=1S/C10H14O2/c11-9-5-1-3-6-2-4(5)8(7(3)9)10(6)12/h3-12H,1-2H2 |
| InChIKey | SPKXYVYIEGWWOZ-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze tetracyclo[5.2.1.02,6.04,8]decane-5,10-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetracyclo[5.2.1.02,6.04,8]decane-5,10-diol?
The IUPAC name of tetracyclo[5.2.1.02,6.04,8]decane-5,10-diol (CID 556428) is tetracyclo[5.2.1.02,6.04,8]decane-5,10-diol.
What is the SMILES notation for tetracyclo[5.2.1.02,6.04,8]decane-5,10-diol?
The canonical SMILES for tetracyclo[5.2.1.02,6.04,8]decane-5,10-diol is OC1C2CC3C4CC2C(C4O)C13.
What is the InChIKey of tetracyclo[5.2.1.02,6.04,8]decane-5,10-diol?
The InChIKey is SPKXYVYIEGWWOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O2/c11-9-5-1-3-6-2-4(5)8(7(3)9)10(6)12/h3-12H,1-2H2.
What are the key properties of tetracyclo[5.2.1.02,6.04,8]decane-5,10-diol?
tetracyclo[5.2.1.02,6.04,8]decane-5,10-diol has a molecular weight of 166.22 g/mol, XLogP of 0.24, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tetracyclo[5.2.1.02,6.04,8]decane-5,10-diol is sourced from PubChem (CID 556428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).